Product Description
| Cat Number | T6S0139 |
|---|---|
| Category | Biochemical |
| Pack Size | 1EA |
| Description | 1. Neobavaisoflavone is isolated as a DNA polymerase inhibitor. 2. Neobavaisoflavone might be a potential anabolic agent to treat bone loss-associated diseases. 3. Neobavaisoflavone has anti-inflammatory activity, can significantly inhibit the production of reactive oxygen species (ROS), reactive nitrogen species (RNS) and cytokines: IL-1β, IL-6, IL-12p4, IL-12p7, TNF-α in LPS+IFN-γ- or PMA- stimulated RAW264.7 macrophages. |
| Molecular Weight | 322.35 |
| Purity | 0.9931 |
| Formula | C20H18O4 |
| Smiles | CC(C)=CCc1cc(ccc1O)-c1coc2cc(O)ccc2c1=O |
| Storage | -20 ℃ |
| View Document | |
| Note | This product is for Research Use Only |
Share Item: