Product Description
| Cat Number | T6S2246 |
|---|---|
| Category | Biochemical |
| Pack Size | 1EA |
| Description | 1. Alisol B 23-acetate (Alisol B Acetate) produces protective effect against ANIT-induced hepatotoxity and cholestasis, due to FXR-mediated regulation of transporters and enzymes. 2. Alisol B 23-acetate produces promotive effect on liver regeneration, due to FXR-mediated regulation of genes involved in hepatocyte proliferation and hepato-protection. 3. Alisol B 23-acetate produces a protective effect against CCl4-induced hepatotoxicity, due to FXR and STAT3-mediated gene regulation. |
| Molecular Weight | 514.74 |
| Purity | 0.9987 |
| Formula | C32H50O5 |
| Smiles | C[C@H](C[C@H](OC(C)=O)[C@H]1OC1(C)C)C1=C2C[C@H](O)[C@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@]3(C)[C@@]2(C)CC1 |
| Storage | -20 ℃ |
| View Document | |
| Note | This product is for Research Use Only |
Share Item: